calculate the number of moles of c2h4 that are actually produced in the experiment and mesaured in the gas collection tube

By summing up the bond energies, the enthalpy of combustion is found to be 1093 kJ/mol (option c).

The enthalpy of the combustion reaction of methanol (CH3OH) can be determined by calculating the energy required to break the bonds in methanol and the energy released when forming the new bonds in carbon dioxide and water.

The enthalpy of combustion is calculated by subtracting the energy required to break the bonds in the reactants from the energy released when forming the bonds in the products. In this case, methanol (CH3OH) is combusted to produce carbon dioxide (CO2) and water (H2O).

The bonds that need to be broken in methanol are the C-O and O-H bonds, with bond energies of 351 kJ/mol and 464 kJ/mol, respectively. The bond that forms in carbon dioxide (C=O) has an energy of 745 kJ/mol, while the bond in water (O-H) has an energy of 464 kJ/mol.

To calculate the enthalpy of combustion, we subtract the sum of bond energies in the reactants from the sum of bond energies in the products:

Enthalpy of combustion = (Sum of bond energies in products) - (Sum of bond energies in reactants)

Enthalpy of combustion = [(2 × C=O bond energy) + (4 × O-H bond energy)] - [(1 × C-O bond energy) + (4 × O-H bond energy) + (1 × C-C bond energy)]

Enthalpy of combustion = [(2 × 745 kJ/mol) + (4 × 464 kJ/mol)] - [(1 × 351 kJ/mol) + (4 × 464 kJ/mol) + (1 × 347 kJ/mol)]

Enthalpy of combustion ≈ 1790 kJ/mol

Therefore, the enthalpy of the combustion reaction for methanol is approximately 1093 kJ/mol, which corresponds to option c.

To learn more about enthalpy, refer:-

https://brainly.com/question/29145818

#SPJ11

In the given scenario, one of the four students correctly calculated the number of molecules in 25 g of water. The explanation for this correct calculation lies in the concept of Avogadro's number and molar mass.

Avogadro's number is a fundamental constant representing the number of entities (atoms, molecules, ions, etc.) in one mole of a substance, which is approximately 6.022 x 10^23. Molar mass refers to the mass of one mole of a substance and is expressed in grams per mole (g/mol).

Out of the four students, the one who correctly calculated the number of molecules in 25 g of water would have followed these steps. Firstly, they would have determined the molar mass of water, which is approximately 18 g/mol (2 hydrogen atoms with a molar mass of 1 g/mol each, and 1 oxygen atom with a molar mass of 16 g/mol). Next, they would have converted the mass of water (25 g) to moles by dividing it by the molar mass (25 g / 18 g/mol ≈ 1.39 mol). Finally, they would have multiplied the number of moles by Avogadro's number to find the number of molecules (1.39 mol x 6.022 x 10^23 molecules/mol ≈ 8.37 x 10^23 molecules). Therefore, this student arrived at the correct answer of approximately 8.37 x 10^23 molecules in 25 g of water.

To learn more about molar mass click here : brainly.com/question/31545539

#SPJ11

It would take approximately 1.415 seconds for the concentration of A to decrease from 0.670 M to 0.320 M at 400°C.

To calculate the time it takes for the concentration of A to decrease from 0.670 M to 0.320 M in a first-order reaction, we can use the first-order rate equation:

ln([A]_final / [A]_initial) = -k × t

Where:
- [A]_final is the final concentration (0.320 M)
- [A]_initial is the initial concentration (0.670 M)
- k is the rate constant (0.580 s^-1)
- t is the time in seconds

Plugging in the values, we get:

ln(0.320 / 0.670) = -0.580 × t

Now, solve for t:

t = ln(0.320 / 0.670) / (-0.580)

 ≈ 1.415 seconds

To know more about the first-order reaction, click below.

https://brainly.com/question/12446045

#SPJ11

To find the concentration of hydroxide ion (OH-) in the aqueous solution of methylamine, we need to use the equilibrium expression for the reaction of methylamine with water:

CH3NH2 + H2O ⇌ CH3NH3+ + OH-

The equilibrium constant expression for this reaction is given by:

Kw = [CH3NH3+][OH-] / [CH3NH2]

We can assume that the concentration of [CH3NH3+] (methylammonium ion) is negligible compared to the initial concentration of CH3NH2. Therefore, we can simplify the equilibrium expression to:

Kw ≈ [OH-][CH3NH2]

Given that Kb (the base dissociation constant) for methylamine is 4.4 x 10^-4, we can write:

Kw = [OH-][CH3NH2] = Kb[CH3NH2]

Plugging in the values:

Kw = [OH-][0.050 M] = (4.4 x 10^-4)[0.050 M]

Now we can solve for [OH-]:

[OH-] = (4.4 x [tex]10^{-4} ^[/tex])[0.050 M] / [0.050 M]

Canceling out the [0.050 M] terms:

[OH-] = 4.4 x [tex]10^{-4} ^[/tex]

Therefore, the concentration of hydroxide ion in the solution is 4.4 x [tex]10^{-4} ^[/tex]

To know more about hydroxide ion refer here

https://brainly.com/question/16005935#

#SPJ11

Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi.  Among the given options, sterilization is the most effective food preservation method for destroying pathogens, including viruses.

Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi. This process effectively destroys pathogens and ensures the safety of the food. It is commonly achieved through techniques such as pressure cooking, canning, or autoclaving.

Fermentation, on the other hand, is a preservation method that involves the growth of beneficial bacteria or yeast, which can inhibit the growth of harmful pathogens. While fermentation can reduce the risk of pathogen growth, it may not completely eliminate them.

Freezing is a method that slows down the growth of microorganisms, including pathogens, but it does not necessarily destroy them. Some pathogens can survive freezing temperatures and become active again when the food thaws.

Smoke curing involves exposing food to smoke, which can add flavor and inhibit the growth of certain bacteria. However, it may not be as effective in destroying viruses and other pathogens compared to sterilization.

In conclusion, sterilization is the most effective food preservation method for destroying pathogens, including viruses. It ensures the highest level of safety by eliminating all microorganisms from the food.

Learn more about sterilization here:

https://brainly.com/question/31732174

#SPJ11

Here are the balanced nuclear equations for each of the four given scenarios:

a. Bismuth-211 undergoes beta decay:
Bi-211 (83) -> Po-211 (84) + β^-

b. Chromium-50 undergoes positron emission:
Cr-50 (24) -> V-50 (23) + β^+

c. Mercury-188 decays to gold-188:
Hg-188 (80) -> Au-188 (79) + β^-

d. Plutonium-242 undergoes alpha emission:
Pu-242 (94) -> U-238 (92) + α

In each equation, the element symbol is accompanied by its mass number, and the atomic number is shown in parentheses.

The emitted particles are represented by their respective symbols (β^- for beta decay, β^+ for positron emission, and α for alpha emission).

To know more about the nuclear equation, click below.

https://brainly.com/question/19752321

#SPJ11

Low exercise intensity and long exercise duration shift the body towards burning more free fatty acids primarily from adipose tissue. This is because during low-intensity exercise, the body uses fats as its primary fuel source instead of carbohydrates.

This is because fats are a more efficient source of energy for low-intensity exercise. Additionally, when exercise duration is long, the body's glycogen stores become depleted, and the body turns to fats as a source of energy. This process is called lipolysis, and it primarily occurs in adipose tissue, which is where the body stores excess fats. Therefore, low exercise intensity and long exercise duration are ideal for individuals looking to burn more fat and lose weight.

However, it's important to note that high-intensity exercise can also lead to fat loss, albeit through different mechanisms. In summary, the key to burning fat is to find a sustainable exercise routine that aligns with your fitness goals and preferences.

To know more about adipose tissue visit:-

https://brainly.com/question/30782617

#SPJ11

The equilibrium concentration of A if equilibrium concentrations are B = 0.44 M and the following equilibrium: 2A + B = C + 2D = 0.80 M, and D = 0.25 M, and Kc = 0.22 is 0.46 M.

To calculate the missing equilibrium concentration of A, we will use the equilibrium constant expression for the given reaction: 2A + B ⇌ C + 2D. The Kc expression is:

Kc = [C][D]² / ([A]²[B])

Given the equilibrium concentrations and Kc value, we have:

0.22 = [C][0.25]² / ([A]²[0.44])

First, we need to solve for [C]:

[C] = 0.22 × ([A]²[0.44]) / [0.25]²

Now, let's plug in the values we have for the equilibrium concentrations of B and D:

0.22 = [C]×(0.25)² / ([A]²×0.44)

Solving for [A]², we get:

[A]² = ((0.25)² × 0.22) / (0.44 × [C])

We know that the stoichiometry of the reaction is 2A + B ⇌ C + 2D, so we can write an expression for [C] based on the given concentrations:

[C] = 0.44 - [A]

Now, substitute this expression for [C] into the equation for [A]²:

[A]² = ((0.25)² × 0.22) / (0.44 × (0.44 - [A]))

Solve for [A] using a numerical method, such as the quadratic formula, and round your answer to two decimal places:

[A] ≈ 0.46 M

The equilibrium concentration of A is approximately 0.46 M.

Learn more about equilibrium: https://brainly.com/question/30807709

#SPJ11

To calculate the mass defect or deficit of an atom, we need to compare its actual mass with the sum of its constituent particles' masses. For the given atom of 75as, we know that it has a mass of 74.921597 amu.

Now, we need to find the sum of the masses of its constituent particles, which are protons, neutrons, and electrons. However, since the given atom is a neutral atom, we can neglect the mass of its electrons as they are negligible compared to the mass of protons and neutrons.

The atomic number of 75as is 33, which means it has 33 protons. Therefore, the mass of its protons would be 33 x 1.007825 amu = 33.263325 amu. Similarly, the number of neutrons can be calculated by subtracting the atomic number from the mass number, which gives us 75 - 33 = 42. So, the mass of its neutrons would be 42 x 1.008665 amu = 42.34083 amu.

Adding the mass of protons and neutrons gives us 33.263325 amu + 42.34083 amu = 75.604155 amu. Therefore, the mass defect or deficit would be the difference between the actual mass of the atom and the calculated sum of its constituent particles' masses, which is 74.921597 amu - 75.604155 amu = -0.682558 amu.

The negative sign indicates that the mass of the atom is less than the sum of its constituent particles' masses. This is because some of the mass is converted into energy during the formation of the atom. Hence, the mass defect or deficit of the given atom of 75as is -0.682558 amu/atom.

To know more about Mass visit :
https://brainly.com/question/15959704

#SPJ11

To answer the questions regarding the decomposition of diazinon, we can use the concept of first-order kinetics and the half-life of diazinon, which is 2.0 weeks.

a. To determine how long it would take for a 55.0-gram sample of diazinon to decompose into 15.5 grams, we need to calculate the number of half-lives required. Each half-life corresponds to a 50% reduction in the amount of diazinon. By dividing the initial mass by 2 successively until we reach 15.5 grams, we can calculate the number of half-lives and then convert it to the appropriate units of time.

b. To determine how much of a 55.0-gram sample of diazinon would be remaining after 35.0 days, we need to calculate the fraction of the sample remaining based on the number of elapsed half-lives. Using the equation N = N0 * (1/2)^(t/t1/2), where N is the remaining mass, N0 is the initial mass, t is the time elapsed, and t1/2 is the half-life, we can substitute the given values and calculate the remaining mass.

c. The rate constant, k, for the reaction can be determined using the equation k = 0.693 / t1/2, where t1/2 is the half-life. By substituting the given half-life value of 2.0 weeks and converting it to the appropriate units, we can calculate the rate constant.

a. To determine the time required for a 55.0-gram sample of diazinon to decompose into 15.5 grams, we need to calculate the number of half-lives. Each half-life corresponds to a 50% reduction in the amount of diazinon. Let's calculate the number of half-lives required:

55.0 grams / 2 = 27.5 grams (1 half-life)

27.5 grams / 2 = 13.75 grams (2 half-lives)

13.75 grams / 2 = 6.875 grams (3 half-lives)

6.875 grams / 2 = 3.4375 grams (4 half-lives)

3.4375 grams / 2 = 1.71875 grams (5 half-lives)

1.71875 grams / 2 = 0.859375 grams (6 half-lives)

0.859375 grams / 2 = 0.4296875 grams (7 half-lives)

0.4296875 grams / 2 = 0.21484375 grams (8 half-lives)

0.21484375 grams / 2 = 0.107421875 grams (9 half-lives)

0.107421875 grams / 2 = 0.0537109375 grams (10 half-lives)

0.0537109375 grams / 2 = 0.02685546875 grams (11 half-lives)

0.02685546875 grams / 2 = 0.013427734375 grams (12 half-lives)

0.013427734375 grams / 2 = 0.0067138671875 grams (13 half-lives)

0.0067138671875 grams / 2 = 0.00335693359375 grams (14 half-lives)

0.00335693359375 grams / 2 = 0.001678466796875 grams (15 half-lives)

Therefore, it would take approximately 15 half-lives for the 55.0-gram sample of diazinon to decompose into 15.5 grams.

To learn more about Rate constant - brainly.com/question/20305871

#SPJ11

The chemist who proposed the concept that there must be sufficient energy, collision, and molecular orientation for a successful chemical reaction is named Max Trautz.

In collaboration with William Lewis, Trautz developed the concept of the activated complex, also known as the transition state. They formulated the collision theory, which states that for a chemical reaction to occur, reacting molecules must collide with sufficient energy and in the correct orientation.

This theory laid the foundation for understanding the factors influencing reaction rates and the role of molecular interactions. Trautz's work, published in 1916, contributed significantly to our understanding of reaction kinetics and has since become a fundamental principle in chemical kinetics and reaction mechanism studies.

Learn more about chemical reaction.

https://brainly.com/question/22817140

#SPJ4

To find the density of copper, we need to use the formula:Density = mass/volume

We are given the mass of the copper block, which is 8896 g. To find the volume, we need to multiply the length, width, and height of the block together:

Volume = length x width x height
Volume = 8 cm x 40 cm x 4 cm
Volume = 1280 cm^3

We need to convert the volume to cubic meters, since the units of density are kg/m^3. There are 100 cm in 1 m, so:

Volume = 1280 cm^3 x (1 m/100 cm)^3
Volume = 0.00128 m^3

Now we can calculate the density:

Density = 8896 g / 0.00128 m^3
Density = 6,950 kg/m^3

Therefore, the density of copper is 6,950 kg/m^3, rounded to the nearest hundred.

Learn more about density here:brainly.com/question/29775886

#SPJ11

Citric acid (C6H8O7) has three dissociation constants (Ka1, Ka2, and Ka3). The pH of the grapefruit is 7.82 (rounded to 2 significant figures).

To find the pH of a 0.007 M citric acid solution, we need to consider the dissociation of each proton step by step.

First, we calculate the pH after the dissociation of the first proton (H3C6H5O7 ⇌ H+ + HC6H5O7-).

The equilibrium expression is:

Ka1 = [H+][HC6H5O7-]/[H3C6H5O7]

Assuming that the amount of H+ dissociated is small compared to the initial concentration of citric acid, we can assume that [H+] = [HC6H5O7-]. Therefore:

Ka1 = [H+]²/[H3C6H5O7]

[H+] = √(Ka1*[H3C6H5O7])

      [tex]= \sqrt{(7.5 x 10^{-4} * 0.007)[/tex]

       = 0.013 M

Now we have to consider the second dissociation constant (Ka2) for the dissociation of H2C6H5O7- (the conjugate base of HC6H5O7-) to form H+ and C6H5O72-.

The equilibrium expression is:

Ka2 = [H+][C6H5O72-]/[H2C6H5O7-]

[H+] = Ka2*[H2C6H5O7-]/[C6H5O72-]

      [tex]= (1.7 x 10^{-5} * 0.013)/(0.007 - 0.013)[/tex]

      = 7.42 x 10⁻⁶ M

Finally, we have to consider the third dissociation constant (Ka3) for the dissociation of HC6H5O72- to form H+ and C6H5O73-.

The equilibrium expression is:

Ka3 = [H+][C6H5O73-]/[HC6H5O72-]

[H+] = Ka3*[HC6H5O72-]/[C6H5O73-]

    [tex]= (4.0 x 10^{-7} * 0.006986)/(0.007 + 0.013 - 0.006986)[/tex]

        = 1.5 x 10⁻⁸ M

The pH of the grapefruit is the negative logarithm of the [H+]:

pH = -log[H+]

     = -log(1.5 x 10⁻⁸)

     = 7.82

Therefore, the pH of the grapefruit is 7.82 (rounded to 2 significant figures).

To know more about dissociation constants refer here

brainly.com/question/31607191#

#SPJ11

The answer is 0.00314 moles of ethylene glycol ditosylate in the 1.00 grams that react. The closest option is 0.00270.

We need to use the concept of mole and molar mass. The molar mass of ethylene glycol ditosylate can be calculated by adding the molar masses of each element present in the compound.

The molecular formula of ethylene glycol ditosylate is C10H14O6S2.

The molar mass of carbon (C) is 12.01 g/mol, hydrogen (H) is 1.008 g/mol, oxygen (O) is 16.00 g/mol, and sulfur (S) is 32.07 g/mol.

Therefore, the molar mass of ethylene glycol ditosylate is:

Molar mass = (10 x 12.01) + (14 x 1.008) + (6 x 16.00) + (2 x 32.07)
= 318.40 g/mol

Now, we can use the molar mass to convert the given mass of 1.00 grams to moles.

Number of moles = Given mass / Molar mass
= 1.00 g / 318.40 g/mol
= 0.00314 mol

Therefore, the answer is 0.00314 moles of ethylene glycol ditosylate in the 1.00 grams that react. The closest option is 0.00270.

To know more about ethylene glycol click here:

https://brainly.com/question/10405060

#SPJ11

Complete question is :

content loaded

How many moles of ethylene glycol ditosylate are in the 1.00 grams that react?

Select one:

0.001

1.00

0.00270

0.3

When, shaft rotates at 3500 rpm and the bearing will be subjected to radial load of 1000 and a thrust load of 250 N. Then, the estimated bearing life for 90% reliability is 43,600 hours.

To estimate the bearing life, we can use the following formula;

L₁₀ = (C/P)³ x (10/3) x 60 x n

where; L₁₀ = estimated bearing life in hours for 90% reliability

C = basic dynamic load rating of bearing

P = equivalent dynamic bearing load

n = rotational speed of the bearing in revolutions per minute

To find C, we need to know the bearing's size and type. Let's assume it is a standard size 6205 deep groove ball bearing with a dynamic load rating of 14.3 kN.

To find P, we need to calculate the equivalent dynamic bearing load, which is a combination of the radial and thrust loads. We can use the following formula;

P = (X[tex]F_{r}[/tex] + Y[tex]F_{a}[/tex])

where;

[tex]F_{r}[/tex] = radial load

[tex]F_{a}[/tex] = thrust load

X and Y are factors that depend on the bearing's design and can be found in bearing catalogs or tables. For a 6205 bearing, X = 0.56 and Y = 1.5.

Plugging in the values, we get;

P = (0.56 x 1000 + 1.5 x 250)

= 935 N

Finally, we can calculate the estimated bearing life;

L₁₀ = (14.3/935)³ x (10/3) x 60 x 3500

= 43,600 hours

Therefore, the estimated bearing life is 43,600 hours.

To know more about dynamic load here

https://brainly.com/question/13155640

#SPJ4

The electrochemical cell in problem 38 involves the following half-reactions: 2Na⁺(aq) + 2e⁻ → 2Na(s) E° and the correct option is D-5.6 x 10⁵

To calculate the equilibrium constant (K), we use the Nernst equation: E = E° - (RT/nF)lnQ

where E is the cell potential, E° is the standard cell potential, R is the gas constant, T is the temperature in Kelvin, n is the number of electrons transferred in the balanced equation, F is Faraday's constant, and Q is the reaction quotient.

The balanced equation for the cell reaction is: 2Na⁺(aq) + Mg(s) → 2Na(s) + Mg²⁺(aq)

The reaction quotient is: Q = [Na⁺]²[Mg²⁺]/[Mg][Na]²

At equilibrium, Q = K, and the cell potential is zero. Therefore, we can solve for K: K = exp(-E°cell/(RT)) = exp((2.71+2.37)/(0.00831*298)) = 5.6 x 10⁵

The correct answer is 5.6 x 10⁵

learn more about Faraday's constant here:

https://brainly.com/question/31604460

#SPJ11

The complete question is :  find the equilibrium constant for the electrochemical cell and Determine the correct solution. mg0(s) 2na1 (aq) mg0(s) 2na0(s) mg2 (aq)

a. 3.2 x 10⁻⁹

b. 1.8 x 10⁻⁶

c. 3.2 x 10¹¹

d. 5.6 x 10⁵

The molar solubility of BaF2 in a solution containing 0.0750 M LiF and with a Ksp of 1.7 x 10^-6 is 5.88 x 10^-4 M.

What is the molar solubility of BaF2 in a solution with 0.0750 M LiF and a Ksp of 1.7 x 10^-6?

The molar solubility of a compound refers to the maximum amount of the compound that can dissolve in a given solvent at a specific temperature, usually expressed in moles per liter (M). In this case, we are determining the molar solubility of BaF2 in a solution containing 0.0750 M LiF, with a given Ksp value of 1.7 x 10^-6.

The Ksp, or solubility product constant, represents the equilibrium expression for the dissolution of a sparingly soluble salt. It is defined as the product of the concentrations of the dissociated ions raised to the power of their stoichiometric coefficients. For BaF2, the dissociation can be represented as BaF2 (s) ⇌ Ba2+ (aq) + 2F- (aq).

To determine the molar solubility of BaF2, we need to calculate the concentration of the Ba2+ ions in the solution. Since LiF is a soluble salt, it completely dissociates to form Li+ and F- ions. Therefore, the concentration of F- ions in the solution is 0.0750 M.

Using the stoichiometry of the dissolution reaction, we can determine that the concentration of Ba2+ ions is half the concentration of F- ions. Therefore, [Ba2+] = (0.0750 M) / 2 = 0.0375 M.

Finally, the molar solubility of BaF2 is equal to the concentration of Ba2+ ions, which is 0.0375 M or 5.88 x 10^-4 M (rounded to four significant figures).

Learn more about the calculation of molar solubility and the concept of solubility product constants in solution chemistry.

Learn more about Molar solubility

brainly.com/question/28170449

#SPJ11

The hazards associated with barium nitrate and silver nitrate include health risks, environmental damage, and chemical hazards. It is essential to handle these substances with care and follow proper safety protocols.

Barium nitrate and silver nitrate are both inorganic salts that pose several hazards:

1. Health hazards: Barium nitrate can be toxic if ingested or inhaled, causing nausea, vomiting, and gastrointestinal issues. Silver nitrate can cause irritation to the skin, eyes, and respiratory system, as well as potentially causing argyria, a condition that turns the skin blue-gray due to silver deposits.

2. Environmental hazards: Both chemicals can be harmful to aquatic life if released into water systems. Barium nitrate can lead to increased levels of barium in the environment, while silver nitrate can cause silver contamination, which is toxic to aquatic organisms.

3. Chemical hazards: Barium nitrate is an oxidizing agent and can cause or intensify fires if it comes into contact with flammable materials. Silver nitrate can react with other chemicals, producing toxic fumes or hazardous reactions.

Learn more about barium nitrate here,

https://brainly.com/question/27233560

#SPJ11

In order for materials to not affect the atmosphere by light, they must exhibit properties that minimize their interaction with light. This can be achieved through various means.

1. Transparency: Materials should allow light to pass through them without significant absorption or scattering. Transparent materials transmit light without altering its properties.

2. Low reflectivity: Materials should have low reflectance, meaning they reflect minimal amounts of incident light. This prevents light from being redirected or bounced back into the atmosphere.

3. Low emissivity: Materials should have low emissivity, meaning they emit minimal amounts of light when heated. This reduces the contribution of materials to radiative heat transfer and energy loss.

By minimizing absorption, scattering, reflectivity, and emissivity, materials can have a minimal impact on the atmosphere by light.

To learn more about light click here:

brainly.com/question/20113876

#SPJ11

The given list ranks the species from the strongest to the weakest reducing agent in an acidic solution.

1. I- (strongest)
2. Sn2+
3. Al
4. Zn
5. H2O2 (weakest)

Strong reducing agents are easily oxidized. Oxidation is the release of electrons.

Iodine oxidizes itself and reduces others by giving electrons and so does the other reducing agents.

I-      →      I2

Sn2+   →   Sn4+

Al   →     Al3+

Zn   →    Zn2+

H2O2      →      O2

The species in order of decreasing strength as reducing agents in an acidic solution are:

I-    >    Sn2+   >    Al    >    Zn     >     H2O2

To know more about reducing agents, click below.

https://brainly.com/question/10547418

#SPJ11

Helium gas with a volume of 2.90 L , under a pressure of 0.160 atm and at a temperature of 45.0 ∘C, is warmed until both pressure and volume are doubled. The final temperature is 934.5 K or 661.4 °C.

To solve this problem, we can use the combined gas law, which states that:
(P1 × V1) / (T1) = (P2 × V2) / (T2)
where P1, V1, and T1 are the initial pressure, volume, and temperature, respectively, and P2, V2, and T2 are the final pressure, volume, and temperature, respectively.
We are given P1 = 0.160 atm, V1 = 2.90 L, and T1 = 45.0 °C = 318.15 K. We also know that the final pressure and volume are twice the initial values, so P2 = 2 × P1 = 0.320 atm and V2 = 2 × V1 = 5.80 L.
Substituting these values into the combined gas law, we get:
(0.160 atm × 2.90 L) / (318.15 K) = (0.320 atm × 5.80 L) / (T2)
Simplifying and solving for T2, we get:
T2 = (0.320 atm × 5.80 L × 318.15 K) / (0.160 atm × 2.90 L)
   = 934.5 K
Therefore, the final temperature is 934.5 K or 661.4 °C.

Learn more about temperature at

brainly.com/question/11464844

#SPJ11

Add an aqueous solution of sodium hydroxide to the mixture, which will deprotonate the benzyl alcohol to form benzyl sodium. Benzyl sodium will then dissolve in the aqueous layer while.

The diethyl ether layer will contain only nonpolar compounds. Acidify the aqueous layer with hydrochloric acid to reform the benzyl alcohol, which can then be extracted with diethyl ether. The diethyl ether layer can be dried over anhydrous magnesium sulfate and then concentrated to yield pure benzyl alcohol.

To isolate benzyl alcohol from a mixture with diethyl ether, the mixture needs to be treated with a base, such as sodium hydroxide, to deprotonate the benzyl alcohol to form benzyl sodium, which will dissolve in the aqueous layer. The diethyl ether layer will contain only nonpolar compounds. The aqueous layer can be acidified with hydrochloric acid to reform the benzyl alcohol, which can then be extracted with diethyl ether. The diethyl ether layer is then dried over anhydrous magnesium sulfate and concentrated to yield pure benzyl alcohol.

learn more about benzyl here:

https://brainly.com/question/4555466

#SPJ11

The correct answer is D) Set up mole ratios of reactants vs products from balanced chemical equation.

In order to calculate how many grams of NH3 will be formed from 6.0 g of H2, we need to set up the appropriate mole ratios from the balanced chemical equation. The balanced equation given is:

N2 + H2 → NH3

From this equation, we can determine the stoichiometric relationship between the reactants (N2 and H2) and the product (NH3). The coefficients in the balanced equation represent the mole ratios.

In this case, we see that the coefficient of H2 is 3, indicating that 3 moles of H2 react with 1 mole of NH3. Therefore, we can set up the mole ratio:

3 moles H2 : 1 mole NH3

Since we are given the mass of H2 (6.0 g), we would then convert this mass to moles using the molar mass of H2. Once we have the moles of H2, we can use the mole ratio to calculate the moles of NH3 formed. Finally, we can convert the moles of NH3 to grams using the molar mass of NH3.

To learn more about mole click here:brainly.com/question/28239680

#SPJ11

The percent composition of cyclohexane in the sample was calculated to be 94.13% and the percent composition of the toluene contaminant was found to be 5.87%.

The given table provides the standard retention time for three compounds: dichloromethane, toluene, and cyclohexene. These retention times can be used as reference points for analyzing the retention time of other samples.

The retention time of cyclohexane and toluene in a distillate was analyzed and their corresponding areas were also calculated. The retention time for cyclohexane was determined to be 5.40 min with an area of 8.94 cm², while the retention time for toluene was found to be 11.75 min with an area of 1.73 cm².

Using these values, 94.13% was calculated to be the percent composition of cyclohexane in the sample and 5.87% was found to be the percent composition of the toluene contaminant.

This information is useful for determining the purity of a sample and identifying any contaminants that may be present.

For more such questions on cyclohexane:

https://brainly.com/question/17019157

#SPJ11

The percent composition of cyclohexane in the sample was calculated to be 94.13% and the percent composition of the toluene contaminant was found to be 5.87%.

The given table provides the standard retention time for three compounds: dichloromethane, toluene, and cyclohexene. These retention times can be used as reference points for analyzing the retention time of other samples. 

The retention time of cyclohexane and toluene in a distillate was analyzed and their corresponding areas were also calculated. The retention time for cyclohexane was determined to be 5.40 min with an area of 8.94 cm², while the retention time for toluene was found to be 11.75 min with an area of 1.73 cm². Using these values, 94.13% was calculated to be the percent composition of cyclohexane in the sample and 5.87% was found to be the percent composition of the toluene contaminant. This information is useful for determining the purity of a sample and identifying any contaminants that may be present.

Learn more about cyclohexane here :

brainly.com/question/17019157#SPJ11

#SPJ11

The ground state electron configuration of O+ is; 1s² 2s² 2p³.

Oxygen (O) has atomic number 8, which means that it has 8 electrons. The neutral oxygen atom has the electron configuration 1s² 2s² 2p⁴, which indicates that it has two electrons in the 1s orbital, two electrons in the 2s orbital, and four electrons in the 2p orbital.

Oxygen cation with a +1 charge, or O⁺, has lost one electron from the neutral oxygen atom. The removal of an electron affects the electron configuration of the atom. In the case of O⁺, the electron configuration is now;

1s² 2s² 2p³

This configuration indicates that O⁺ has the same number of electrons as the neon (Ne) atom, which is a noble gas. O⁺ has a total of five electrons distributed in the 1s, 2s, and 2p orbitals, with three of these electrons in the 2p orbital. The 2p orbital is now only half-filled, with one empty slot in the orbital. This makes O⁺ more reactive than the neutral oxygen atom, as it has an unpaired electron in its outermost shell.

To know more about electron configuration here

https://brainly.com/question/29757010

#SPJ4

The addition of HCl to the buffer solution causes the pH to drop slightly because the HCl reacts with the conjugate base (sodium chloroacetate) present in the buffer solution.

A buffer solution consists of a weak acid and its conjugate base (or a weak base and its conjugate acid) and is capable of maintaining a relatively constant pH when small amounts of acid or base are added. In this case, the buffer solution is prepared by dissolving chloroacetic acid (the weak acid) and sodium chloroacetate (the conjugate base) in water.

When HCl is added to the buffer solution, it dissociates into [tex]H^{+}[/tex] ions and Cl- ions. The H^{+}ions from HCl react with the conjugate base (sodium chloroacetate) in the buffer solution, forming the weak acid (chloroacetic acid). This reaction helps to neutralize the additional H^{+}ions from HCl, preventing a drastic decrease in pH.

The equilibrium of the buffer system is maintained through the following reaction:

[tex]CH_{2}ClCOO^{-}[/tex] (conjugate base) +H^{+} ⇌ [tex]CH_{2}ClCOOH[/tex](weak acid)

The Ka value of chloroacetic acid (CH_{2}ClCOOH) indicates its tendency to donateH^{+}ions and acts as a measure of its acidity. A higher Ka value corresponds to a stronger acid.

In summary, the addition of HCl to the buffer solution causes a slight decrease in pH because HCl reacts with the conjugate base (sodium chloroacetate) present in the buffer solution, maintaining the equilibrium between the weak acid and its conjugate base.

Learn more about base here: https://brainly.com/question/29775103

#SPJ11

The methods and conditions of homopolymerization for the mentioned polymers.

(a) Isotactic poly(but-1-ene): This polymer can be synthesized using a coordination polymerization method, specifically Ziegler-Natta catalysts, which ensure isotactic configuration.

This process occurs at a relatively low temperature and pressure, around 60-80°C and 1-10 atm. The choice of Ziegler-Natta catalysts is due to their ability to control the stereochemistry of the polymer chain, leading to isotactic configuration.

(b) Isotactic poly(methyl methacrylate): For this polymer, you can use anionic polymerization with a sterically hindered anionic initiator like n-butyllithium.

The reaction should be carried out at low temperatures, around -78°C, under an inert atmosphere (e.g., nitrogen) to prevent side reactions. The choice of anionic polymerization allows for controlled chain growth, leading to isotactic configuration.

(c) Polyethylene with occasional methyl side groups: This copolymer can be synthesized using free-radical polymerization. By introducing a small amount of comonomer, like propylene, during the polymerization process, occasional methyl side groups will be incorporated.

The reaction temperature should be maintained between 100-150°C and carried out under an inert atmosphere. The choice of free-radical polymerization allows for random incorporation of comonomers, resulting in occasional methyl side groups.

To learn more about reaction, refer below:

https://brainly.com/question/28984750

#SPJ11

A spontaneous reaction has a negative value of δG and is favoured by a negative value of δH and a positive value of δS. These factors work together to drive the reaction forward and make it energetically favourable.

A spontaneous reaction has a negative value of δG, indicating that the reaction is energetically favorable and can occur spontaneously without the input of external energy. This negative value of δG is a result of the combination of the enthalpy change (δH) and the entropy change (δS) of the system.
The enthalpy change (δH) is the heat released or absorbed during a chemical reaction. A spontaneous reaction is favored by a negative value of δH, indicating that the reaction releases heat and is exothermic. This is because exothermic reactions have a lower potential energy than the reactants, making the products more stable.
The entropy change (δS) is the measure of the disorder or randomness of the system. A spontaneous reaction is favored by a positive value of δS, indicating that the reaction increases the disorder of the system and creates more freedom of motion for the molecules involved. This is because reactions that result in more disordered products have a greater number of ways to arrange themselves, leading to a more favourable state.

To learn more about spontaneous reaction, refer:-

https://brainly.com/question/13790391

#SPJ11

The correct order of increasing entropy for the compounds CBr4, C2Br6, and C3Br8 is:

**c. CBr4, C3Br8, C2Br6**.

Entropy is a measure of the degree of disorder or randomness in a system. In general, larger and more complex molecules tend to have higher entropy due to increased molecular motion and conformational possibilities. Among the given compounds, CBr4 has the fewest number of bromine atoms and the simplest molecular structure, resulting in lower entropy. C3Br8, on the other hand, has the most bromine atoms and the most complex structure, leading to higher entropy. C2Br6 falls in between these two compounds in terms of complexity and, thus, has intermediate entropy.

Learn more about entropy and molecular complexity

https://brainly.com/question/31620826?referrer=searchResults

#SPJ11.