Find the equation of the parabola with the following properties. Express your answer in standard form. Focus at (-5,-2) Directrix is the line y = 1

Answers

Answer 1

Since the focus is at (-5, -2) and the directrix is the line y = 1, we know that the vertex of the parabola lies halfway between them, which is at (-5, -0.5).

Since the directrix is a horizontal line, the parabola opens downward. Let (x, y) be a point on the parabola, and let d be the distance from (x, y) to the directrix (which is y - 1). Then the distance from (x, y) to the focus is d + 0.5 (half the distance between the focus and directrix).

Using the distance formula, we have:

√[(x - (-5))² + (y - (1))²] = d + 0.5

Simplifying, we get:

(x + 5)² + (y - 1)² = (d + 0.5)²

Since the point (x, y) lies on the parabola, its distance to the directrix is equal to its distance to the focus:

d = |y - 1 - (-0.5)| = |y - 0.5|

Substituting this into the equation above, we get:

(x + 5)² + (y - 1)² = (|y - 0.5| + 0.5)²

Expanding and simplifying, we get:

x² + 10x + y² - 2y - 12|y - 0.5| - 12 = 0

To put this in standard form, we need to eliminate the absolute value. We consider two cases:

Case 1: y ≥ 0.5

In this case, |y - 0.5| = y - 0.5, so we have:

x² + 10x + y² - 2y - 12y + 6 - 12 = 0

Simplifying, we get:

x² + 10x + y² - 14y - 18 = 0

Completing the square, we get:

(x + 5)² + (y - 7/2)² = 99/4

This is the standard form of the equation of the parabola.

Case 2: y < 0.5

In this case, |y - 0.5| = -(y - 0.5) = 0.5 - y, so we have:

x² + 10x + y² - 2y - 6(0.5 - y) - 12 = 0

Simplifying, we get:

x² + 10x + y² - 2y + 3 = 0

Completing the square, we get:

(x + 5)² + (y - 1)² = 21

This is also the standard form of the equation of the parabola, but it corresponds to a different part of the curve than the previous equation (since it has a different sign for the y-term).

To know more about parabola refer here:

https://brainly.com/question/31142122

#SPJ11


Related Questions


[tex] - \sqrt{49 {x}^{2} } [/tex]
simplify expression

Answers

Step-by-step explanation:

Given

[tex] - \sqrt{49 {x}^{2} } \\ = - \sqrt{ {7}^{2} {x}^{2} } \\ = - 7x[/tex]

Hope it will help :)

I need help my brain is too small to answer this

Answers

Answer:

5/6 or 0.83

Step-by-step explanation:

5 ÷ 6 = 0.83 or 5/6

Factor completely

1/25-25z^2

Answers

Answer:

1/25(1-25z)(1+25z)

Step-by-step explanation:

your welcome : )

Which of the following angles DO NOT have equal measure when a pair of parallel lines is crossed by a transversal?

Answers

The angles are missing

HELP HELP ME PLSS!! Please I really need help....

Answers

The sum of the measures of the interior angles of a decagon (10 sided polygon) is 1,440

Suppose we know that the birth weight of babies is Normally distributed with a mean 3500g and a standard deviation of 500g. What is the probability that a baby is born that weighs less than 3100g?

Answers

Answer:

0.21186

Step-by-step explanation:

We solve the above question using the z score formula.

z = (x-μ)/σ, where

x is the raw score = 3100g

μ is the population mean = 3500g

σ is the population standard deviation = 500g

z = 3100 - 3500/500

z = -0.8

Probability value from Z-Table:

P(x<3100) = 0.21186

The probability that a baby is born that weighs less than 3100g is 0.21186

he equation shows the relationship between x and y:

y = −7x + 9

What is the slope of the equation?

−7
−2
7
9

Answers

Answer:

-7

Step-by-step explanation:

y=-7x+9

y=mx+b

m=slope

y=y-intercept

Which term has the definition "The value that is half way between the minimum and the median

Answers

The IQR describes the middle 50% of values when ordered from lowest to highest. To find the interquartile range (IQR), ​first find the median (middle value) of the lower and upper half of the data. These values are quartile 1 (Q1) and quartile 3 (Q3). The IQR is the difference between Q3 and Q1.

It’s sad when I help people because they don’t do the same thing to so please please please... answer me once :((((((((((((((((((((((((((((((((((((((((((((((

Answers

I believe he has four model trains
Hope this helps

Step-by-step explanation:

Equation = 4m=16

Answer= 4m=16

m=16/4 = 4

So Tyrone has 4 model planes.

Don't know if its correct

is 14.16 or 14.6 the higher number

Answers

Answer:

14.6 because 14.6 is equivalent to 14.60

Step-by-step explanation:

Answer:

14.6

Step-by-step explanation:

It would be 14.6 because 14.6 is basically 14.60

So you would compare 14.16 to 14.60

I need help I don’t wanna failed this class:(

Answers

the answer is 20.
sun.=3,400
mon.=53,700
tue.=12,000
wed.=9,623
thur.=27,900
fri.=68,210
sat.=7,954
therefor, friday is the highest and sunday is the lowest. 68,210/3,400= 20.06 which is about 20. hope this helped!

Factorise : x³ + x - 3x² -3​

Answers

Answer:

(x²+1)(x-3)

Step-by-step explanation:

Factorize x³ + x - 3x² -3​

x³-3x²+x-3

Factorize

x²(x-3)+1(x-3)

= (x²+1)(x-3)

Hence the factorized form is (x²+1)(x-3)

one answer question

Answers

Answer:

c is the answer you will get you answer as a rational number (hope I'm not wrong)

How do i learn this subject easily?

Answers

Answer:

try to download app that can help you, watch videos on how to do the problems or ask help with someone you know or just take notes that makes you understand better

Step-by-step explanation:

Answer: What subject ???

Explanation:

•Take notes
•Watch tutorials
•Practice daily
•Practice it with someone who’s good at that subject

I WILL MARK BRAINIEST PLEASE HELP

Answers

Uuuuuuuuu no se yo no hablo ingles

Answer: do you still need help

Step-by-step explanation:

One number exceeds another by 5. The sum of the numbers is 89. What are the numbers ?

Answers

Answer:

42

Step-by-step explanation:

89-5=84

84÷2=42

and reverse it to check

(42+5)+(42)=89

PLS HELP! i rly need help on this. it’s hard for me.

1: what is the name of that figure??
2: what would be the cross section from a vertical slice of the figure??

Answers

Answer:

The 3D solid shown in the image is a hexagonal pyramid. If we made a cross section with a vertical slice (top to bottom), we would have an isosceles triangle.

Useful Extra Knowledge:

However—and this isn't a question here, but just useful knowledge—if we made a cross section with a horizontal slice (left to right or right to left), we would have a regular hexagon. If it were a diagonal cross section, we would have an irregular hexagon.

Step-by-step explanation:

First, what's the difference between a sphere, a cylinder, a pyramid, a cone, and a prism? These are all 3D solids, but in your case, an explanation of what they are may be a good refresher:

A sphere is a 3D solid where every point is equidistant from the center point. Basically, it's a 3D circle. It's completely round.A prism is a 3D solid with straight, parallel sides and a polygonal base.A cylinder is a 3D solid with straight, parallel sides and a circular baseA pyramid is a 3D solid with sides that converge at a common vertex and a polygonal base.A cone is a 3D solid with sides that converge at a common vertex and a circular base.

We definitely know this shape can't be a sphere! It's not completely round! Actually, take a closer look: there's no hint of a circle anywhere in the figure. It can't be a cylinder nor a cone.

This means it's either a pyramid or a prism. But, going back to the definitions above, let's redefine the difference between the two: pyramids have only one base and only triangular faces, while prisms have two bases and rectangular faces.

How many bases does this figure have? It has one base. And what shape are its faces? They're all triangles! This means we have to be looking at a pyramid.

So, you may think, that solves it. We're looking at a pyramid.

Sorry, buddy. It's not that easy. We can classify this figure even further. How do we do this? We use its base! And what type of polygon is the base? When we count the sides of the base, we find six sides, which means this shape is a hexagon. So this is a hexagonal pyramid, right?

Actually, there's one more specification we could give this. That hexagon has sides that are all equal to each other. That may not seem special to you, but there's a special term given to polygons who have equal sides and equal inner angles: they are called regular polygons.

That description matches the base of our shape, right? So, now we have the name of the figure: it's a regular hexagonal pyramid.

Now, what about the cross section? This means we're taking a piece of that solid, like cutting into a cake with a knife. Who likes cake here?

I digress. This piece, the cross section of the 3D solid, becomes a 2D shape. Now, the question asks for the shape of a vertical cross section, which means up and down, like the y-axis on the coordinate plane/Cartesian plane.

So, imagine taking a butter knife and slicing right down the middle of that bad boy. If you get the middle point exactly, you'll have two equal halves which would look like triangles with two equal sides: an isosceles triangle.

That's assuming you look straight on at them. If you veered to the side a little, you'd find a scalene triangle (a triangle with no equal sides).

But, should you miss the center a little, you'd get a trapezoid instead, because part of the top would be missing.

But I'm assuming the question is asking about a vertical slice exactly down the middle and viewed straight on. In that case, your answer is an isosceles triangle.

I droned on for a bit, I know. But hopefully this helps you understand the concept better! Have a great day!

between which two consecutive integers does the square root of 830 lie ​

Answers

28^2=784

29^2=841

784<830<841

therefore sqrt784<sqrt830<sqrt841

therefore 28<sqrt830<29

Done!

The sum of two integers is - 5 and their difference is 11.
What are the two numbers

Answers

Can help I’m not in that math still

Sung loo worked 54 hours during a special sale at the store. 10 hours was time and a half, and 4 hours were at double time. Her regular rate is $6.86. How much would Sung Loo make?

Answers

Answer:

$432.18

Step-by-step explanation:

Time and a half = 50% more pay rate / 1.5*6.86 = $10.29 per hour

Double time = 2*6.86 = $13.72 per hour

Rest of the time => At regular rate

Total Amount = 10(10.29) + 4(13.72) + (54 - 10 - 4)(6.86)

                       = 10(10.29) + 4(13.72) + (40)(6.86)

                       = $ 432.18

Answer:

so 10 hours was 1,5 time and 4 hours was 2 (double) time Her regular rate is $6,86/h so 10 h with 1,5 time make 10*1,5 = ? and 4 h with 2 time make 4*2 = ? total how much you get multiplie by 6,86 and will get in this way easy sure the correct answer.

Find the height of a cone that has a radius of 3 in and a volume of 96.91 in.

Answers

Answer:

thank you lil shawty

Step-by-step explanation:

Use the original price and the markup to find the retail price.

Original price $68; Markup 15%

The retail price is $________?​
how I did it 68 x .15= 45.33333 rounded = 4.53
68 + 4.53 = 72.5 then I added a 0, 72.50
is 72.50 the answer?

Answers

Answer:

15% of $68 is $10.2

$68 + $10.2 = $78.2

The retail price is $78.20

yooooo please help lol

Answers

Answer:

You first want to divide 210 by 50 2/3. once you do that you will get 35/251 or 0.13944

Now you should be able to make about $44 dollars

Step-by-step explanation:

Are the ratios 2:4 and 5:6 equivalent? yes or no ​

Answers

Answer:

No

Step-by-step explanation:

If you try to multiply the 2:4 to change it to 5:6 , you can't because 5 is an odd number and 2 is and even

The difference of a number and seven

Answers

Answer: x-7

Step-by-step explanation:

Answer:

x -- 7

Step-by-step explanation:

help and i’ll give extra pounts

Answers

Answer:

C

Step-by-step explanation:

ZPRS and ZSRQ are supplementary angles.
85
Р
R
Q
What is the measure of ZSRQ?
O 5
O 15
O 95
O 105

Answers

Answer: 95

Step-by-step explanation: All supplementary angles always have to equal 180 degrees which means that you have to only do 180-85 and boom- 95- that is ur answer. Plz mark Brainliest:).

Help Please!? Thank You!

Answers

A. left 2 units

the vertex form of a parabola is
y = a(x-h)^2 + k
(h,k) is the point of the vertex

since h is -2 in (x+2)^2
the function is shifted 2 units left

how to find LCM of 58??​

Answers

Answer:

Find the prime factorization of 58. 58 = 2 × 29.

Multiply each factor the greater number of times it occurs in steps i) or ii) above to find the LCM: LCM = 2 × 2 × 2 × 2 × 2 × 2 × 29.

LCM = 1856.

Step-by-step explanation:

What is the interest rate in A = 12,000(1 + 0.07/4)^(4)(4)

Answers


a=(3•107^16)/(40•400^14)
Other Questions
small changes in the orbits of planets caused by the gravitational pull of the other planets in the solar system are called: What is the free energy change in kJmol associated with the following reaction under standard conditions? CH3COOH(l)+2O2(g)2CO2(g)+2H2O(g) The standard free energy of formation data are as follows: Gf,CH3COOH(l)=-389.9kJmolGf,CO2(g)=-394.4kJmolGf,H2O(g)=-228.6kJmol TRUE/FALSE. each individual experiences pain differently. it has been found that depending on your culture Which of the following bodies of evidence support the African model for modern human origins?-genetic evidence-fossil evidence-written evidence-archaeological evidence a low level of _____ is the main reason for the uncontrollable shaking seen in patients with parkinson's disease and in patients who are taking conventional antipsychotics. Four equal strips A B C and D were cut from a potato whose cell sap concentration was 28.5%sugar. The strips were placed in sugar solutions of different concentrations as follows;A-10%,B-15%,C-25%,D-35%. 1.What changes would you expect in strips A and D? 2.Account for the changes in A and D. insulin: a. tends to lower blood concentrations of glucose, amino acids, and fatty acids. b. promotes metabolism of glucose by tissue cells. c. is produced by beta cells. d. all of the above are true. El futuroUse the survey questions you wrote in the review activity. Ask your friends or other young people the questions you wrote about their plans for the future. When you have collected all of your data, create a presentation of your results.Your presentation should include the following:the purpose of your surveya summary of your resultsa graphic presentation of your resultsexamples of surprising or unexpected answersfuture-tense verbs and expressionsvocabulary and expressions related to professions regarding the goal-setting theory, a client who has more ________ selected goals will have greater _________ motivation. how to sketch the wave function of the hydrogen atom ground state samples of size 10 are selected from a manufacturing process. the mean of the sample ranges is 0.8. what is the estimate of the standard deviation of the population? (round your answer to 3 decimal places.) Which of the following statements best describes a purpose for preinstruction assessment?A. To communicate students' strengths and weaknesses to parentsB. To determine the level of complexity at which to begin a new topicC. To monitor students' progress toward meeting instructional objectivesD. To evaluate students' performance and to assign grades fill in the blank. the [oh-] of a 0.010 m ba(oh)2 solution is _____ m and the poh is equal to _____. suppose that list a contains 10 numbers with median 38 mean 34 and standard deviation 6 FILL IN THE BLANK. Consumer products are classified into four categories like convenience or shopping goods based on the effort the consumer spends on the decision, the _______, and the frequency of purchase. 1) amount of money the customer is willing and able to spend O2) number of competing or substitute products O3) demographics of the consumer 4) attributes used in making the purchase decision 5) consumer segmentation characteristics what is another way to refer to the hierarchy that exists in the culinary world muscle cells can use the _____ energy system to obtain energy. group of answer choices a) pcr-atp b) oxygen c) lactic acid according to a feminist perspective on global development, personal development must coincide with political and social action. T or F draw the structure of n-ethyl-1-hexanamine or n-ethylhexan-1-amine. fill in the code for the cout statement that will output (with description) // the area