Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi. Among the given options, sterilization is the most effective food preservation method for destroying pathogens, including viruses.
Sterilization is a food preservation method that involves subjecting food to high temperatures to eliminate all forms of microorganisms, including bacteria, viruses, and fungi. This process effectively destroys pathogens and ensures the safety of the food. It is commonly achieved through techniques such as pressure cooking, canning, or autoclaving.
Fermentation, on the other hand, is a preservation method that involves the growth of beneficial bacteria or yeast, which can inhibit the growth of harmful pathogens. While fermentation can reduce the risk of pathogen growth, it may not completely eliminate them.
Freezing is a method that slows down the growth of microorganisms, including pathogens, but it does not necessarily destroy them. Some pathogens can survive freezing temperatures and become active again when the food thaws.
Smoke curing involves exposing food to smoke, which can add flavor and inhibit the growth of certain bacteria. However, it may not be as effective in destroying viruses and other pathogens compared to sterilization.
In conclusion, sterilization is the most effective food preservation method for destroying pathogens, including viruses. It ensures the highest level of safety by eliminating all microorganisms from the food.
Learn more about sterilization here:
https://brainly.com/question/31732174
#SPJ11
Which of the following is not a common solvent used for acquiring a 'H NMR spectrum? CDCl_3 CCl_4 CH_3 OH CH_3 OH D_2
In nuclear magnetic resonance (NMR) spectroscopy, different solvents are used to dissolve and analyze compounds. [tex]CH_{3} OH[/tex] (methanol) is not a common solvent used for acquiring an 'H NMR spectrum.
In nuclear magnetic resonance (NMR) spectroscopy, different solvents are used to dissolve and analyze compounds. Common solvents for acquiring 'H NMR spectra include [tex]CDCl_{3}[/tex](deuterated chloroform), CCl4 (carbon tetrachloride), and [tex]D_{2} O[/tex] (deuterated water). However, [tex]CH_{3} OH[/tex] (methanol) is not typically used as a solvent for acquiring 'H NMR spectra.
The choice of solvent in NMR spectroscopy is crucial because it can affect the chemical shift values and the quality of the spectrum. Solvents like [tex]CDCl_{3}[/tex], [tex]CCl_{4}[/tex], and[tex]D_{2} O[/tex] are commonly used because they are deuterated, meaning that they contain isotopes of hydrogen (deuterium) that do not produce signals in the 'H NMR spectrum. This allows for a clear interpretation of the signals from the compound of interest.
On the other hand,[tex]CH_{3} OH[/tex] (methanol) is not deuterated and contains protons that would contribute to the 'H NMR spectrum. Its use as a solvent could lead to overlapping signals and interfere with the analysis of the compound being studied, which is why it is not commonly used for acquiring 'H NMR spectra.
Learn more about 'H NMR spectra here:
https://brainly.com/question/9784910
#SPJ11
what is the coordination number around the central metal atom in dichlorobis(ethylenediamine)platinum(iv) chloride ([pt(en)₂(cl)₂]cl₂, en = h₂nch₂ch₂nh₂)?
The coordination number around the central metal atom in dichlorobis(ethylenediamine)platinum(iv) chloride ([Pt(en)₂(Cl)₂]Cl₂, en = H₂NCH₂CH₂NH₂) is 6.
This is because there are two ethylenediamine (en) ligands and two chloride (Cl) ligands, each of which has two electron pairs to donate to the coordination sphere of the platinum (Pt) central metal atom. Therefore, the total number of ligands bound to the central metal atom is 6, giving a coordination number of 6.
We can find the coordination number of compounds by:
1. Identify the central metal atom: In this complex, the central metal atom is platinum (Pt).
2. Count the ligands attached to the central metal atom: There are two ethylenediamine (en) ligands and two chloride (Cl) ligands.
3. Determine the coordination number: Each ethylenediamine (en) ligand has two donor atoms (N), while each chloride (Cl) ligand has one donor atom. So, the total number of donor atoms is (2 x 2) + (2 x 1) = 6.
Therefore, the coordination number around the central metal atom (platinum) in dichlorobis(ethylenediamine)platinum(IV) chloride is 6.
For more questions on coordination numbers: https://brainly.com/question/12498196
#SPJ11
When an electron in an unknown atom transitions from the n=3 to n=1 energy state, which statement correctly describes how the kinetic energy (KE), and potential energy (PE) of the excited electron changes in response to this transition to the n=1 energy state? KE decreases and PE increases KE decreases and PE decreases KE increases and PE increases KE increases and PE decreases
When an electron in an unknown atom transitions from the n=3 to n=1 energy state, the correct statement describing the change in kinetic energy (KE) and potential energy (PE) of the excited electron is:
KE increases and PE decreases.
As the electron transitions from a higher energy level (n=3) to a lower energy level (n=1), it moves closer to the nucleus. In the process, the electron loses potential energy because it is now in a more stable, lower energy state. Since potential energy decreases, kinetic energy must increase to conserve the total energy of the electron. Therefore, KE increases and PE decreases during this transition.
Learn more about the electron transition: https://brainly.com/question/29221248
#SPJ11
Nickel can be plated from aqueous solution according to the following half reaction. How long would it take (in min) to plate 29.6 g of nickel at 4.7 A? Ni2+(aq) + 2 e- --> Ni(s)3.5*10^2 min5.9 *10^2 min1.7 *10^2 min6.2 * 10^2 min4.8 * 10^2 min
The time required to plate 29.6 g of nickel at 4.7 A is approximately 348 minutes or 5.8 hours. To calculate the time required to plate 29.6 g of nickel at 4.7 A, we need to use Faraday's law of electrolysis,
Which states that the amount of metal plated is directly proportional to the amount of electric charge passed through the solution.
The half reaction given in the question shows that 2 electrons are needed to plate 1 nickel ion (Ni2+) into solid nickel (Ni). Therefore, the amount of charge required to plate 1 mole of nickel is 2 * 96,485 C/mol = 192,970 C/mol.
The molar mass of nickel is 58.69 g/mol, so the number of moles in 29.6 g is 29.6 g / 58.69 g/mol = 0.504 mol.
The total charge required to plate this amount of nickel can be calculated as follows:
Charge (C) = 0.504 mol * 192,970 C/mol = 97,317 C
Now we can use the formula:
Time (s) = Charge (C) / Current (A)
Converting the answer to minutes, we get:
Time (min) = Time (s) / 60
Substituting the given values, we get:
Time (min) = 97,317 C / 4.7 A / 60 = 348.1 min
Therefore, the time required to plate 29.6 g of nickel at 4.7 A is approximately 348 minutes or 5.8 hours.
In terms of the answer choices provided, the closest option is 4.8 * 10^2 min, which is equivalent to 480 min or 8 hours. This is slightly higher than the calculated value of 348.1 min, but it is reasonable given that the actual plating process may have some additional factors that could affect the outcome.
For more such questions on electrolysis
https://brainly.com/question/12994141
#SPJ11
It would take approximately 352 minutes (5.9 hours) to plate 29.6 g of nickel at 4.7 A.
The amount of charge needed to plate 1 mole of nickel is 2 Faradays or 96485 C. The molar mass of nickel is 58.69 g/mol. Therefore, the amount of charge required to plate 29.6 g of nickel is (29.6 g / 58.69 g/mol) × 2 × 96485 C/mol = 3.07 × 10^6 C.
The current, I = Q/t, where Q is the charge and t is the time in seconds. Therefore, t = Q/I = (3.07 × 10^6 C) / (4.7 A) = 6.53 × 10^2 s or 352 minutes. It would take approximately 352 minutes (5.9 hours) to plate 29.6 g of nickel at 4.7 A. The amount of charge required to plate the given amount of nickel is calculated using Faraday's law, which is then divided by the given current to obtain the required time. The final result is approximately 352 minutes.
learn more about nickel here:
https://brainly.com/question/9758227
#SPJ11
classify the bonds as ionic, polar covalent, or nonpolar covalent. n-f se-cl rb-f na-f f-f i-i
Ionic bonds are formed between a metal and a nonmetal, where one atom loses one or more electrons to another atom that gains those electrons.
Polar covalent bonds are formed between two nonmetals that share electrons unequally, creating partial positive and negative charges. Nonpolar covalent bonds are formed between two nonmetals that share electrons equally, creating no partial charges. Using this information, we can classify the bonds as follows:
N-F: Polar covalent bond
Se-Cl: Polar covalent bond
Rb-F: Ionic bond
Na-F: Ionic bond
F-F: Nonpolar covalent bond
I-I: Nonpolar covalent bond
Note that for N-F and Se-Cl, the electronegativity difference between the atoms is greater than 0.5 but less than 1.7, so the bonds are considered polar covalent. For Rb-F and Na-F, the electronegativity difference is greater than 1.7, so the bonds are considered ionic. For F-F and I-I, the electronegativity difference is zero, so the bonds are considered nonpolar covalent.
For more questions like bonds visit the link below:
https://brainly.com/question/7140445
#SPJ11
the alpha carbon of all the amino acids is a chirality center except for
Aspartic Acid
Glycine
Arginine
Threonine
Proline
The alpha carbon of all amino acids is a chirality center except for Glycine. Glycine is unique because its side chain is a hydrogen atom, which makes its alpha carbon achiral. The other amino acids listed (Aspartic Acid, Arginine, Threonine, and Proline) all have chiral alpha carbons.
This means that it has four different groups bonded to it and can exist in two enantiomeric forms (mirror images). Aspartic acid, arginine, threonine, and proline all have a central alpha carbon that is a chirality center, while glycine does not have a chiral center because it has two hydrogen atoms bonded to its alpha carbon.
Thus, the long answer to your question is that the alpha carbon of all amino acids, except glycine, is a chirality center, which allows them to exist in two different forms.
To know more about amino acids visit:-
https://brainly.com/question/30586602
#SPJ11
what is the mass defect of sn the hydrogen atom has a mass of 1.00783 and the neutron has a mass of 1.00867
The mass defect of Sn is 50.363175 amu. The mass of the nucleus is less than the sum of its individual nucleons due to the release of binding energy during nuclear formation.
The mass defect (Δm) of a nucleus can be calculated using the formula:
Δm = Z(m_p) + N(m_n) - M
where Z is the number of protons, m_p is the mass of a proton, N is the number of neutrons, m_n is the mass of a neutron, and M is the actual mass of the nucleus.
For Sn, the atomic number is 50, so Z = 50. The number of neutrons can vary, but let's assume it has the most stable isotope, which is Sn-120. This means N = 70.
The mass of a proton is 1.007276 amu, and the mass of a neutron is 1.008665 amu. The actual mass of Sn-120 can be found in the periodic table, which is 119.902199 amu.
Using the formula above, we get:
Δm = 50(1.007276) + 70(1.008665) - 119.902199
= 50.363175 amu
Therefore, the mass defect of Sn-120 is 50.363175 amu.
To know more about the mass defect refer here :
https://brainly.com/question/11624098#
#SPJ11
complete and balance the following oxidation–reduction reaction in basic solution: cr1oh231s2 clo-1aq2¡cro4 2-1aq2 cl21g2
To balance the oxidation-reduction reaction in basic solution:
Cr(OH)₂ + ClO⁻ → CrO₄²⁻ + Cl₂
Here's the balanced equation:
6Cr(OH)₂ + 14ClO⁻ + 7H₂O → 6CrO₄²⁻ + 14Cl⁻ + 12OH
1. Identify the elements undergoing oxidation and reduction: Chromium (Cr) and Chlorine (Cl).
2. Balance the atoms in the equation except for H and O: The Cr is already balanced on both sides, while there are 14 Cl on the left side and 14 Cl on the right side, so the Cl atoms are balanced.
3. Balance the oxygen (O) atoms by adding H₂O molecules: There are 7 O atoms in the dichromate ion (CrO₄²⁻) on the right side, so we add 7 H₂O molecules on the left side.
Cr(OH)₂ + ClO⁻ + 7H₂O → CrO₄²⁻ + Cl₂
4. Balance the hydrogen (H) atoms by adding OH⁻ ions: There are 14 H atoms on the left side (from the 7 H₂O molecules), so we add 14 OH⁻ ions on the right side.
Cr(OH)₂ + ClO⁻ + 7H₂O → CrO₄²⁻ + Cl₂ + 14OH⁻
5. Balance the charges by adding electrons (e⁻): The total charge on the left side is -2 (from Cr(OH)₂), and on the right side, it is -2 (from CrO₄²⁻) and -2 (from Cl₂). To balance the charges, we need to add 2 electrons on the left side.
Cr(OH)₂ + ClO⁻ + 7H₂O + 2e⁻ → CrO₄²⁻ + Cl₂ + 14OH⁻
6. Verify the balance of atoms and charges: The atoms and charges are now balanced on both sides.
Final balanced equation: 6Cr(OH)₂ + 14ClO⁻ + 7H₂O + 2e⁻ → 6CrO₄²⁻ + 14Cl⁻ + 14OH⁻.
To learn more about oxidation-reduction:
https://brainly.com/question/13182308
#SPJ11
to what volume should you dilute 50 ml of a 12 m stock hno3 solution to obtain a 0.137 hno3 solution?
To obtain a 0.137 HNO3 solution from a 12 M stock solution, you need to dilute it to a certain volume.
The first step is to use the formula C1V1 = C2V2, where C1 is the initial concentration, V1 is the initial volume, C2 is the final concentration, and V2 is the final volume. Rearranging this formula, you can find the final volume needed:
V2 = (C1V1) / C2
Plugging in the values, you get:
V2 = (12 M x 50 ml) / 0.137 M
V2 = 4381.75 ml or 4.38175 L
Therefore, to obtain a 0.137 HNO3 solution from a 12 M stock solution, you need to dilute 50 ml of the stock solution to a final volume of 4.38175 L. This can be achieved by adding the appropriate amount of solvent, such as water, to the stock solution.
It is important to note that when diluting acids, you should always add the acid to the solvent slowly and with constant stirring to avoid splashing or spilling.
For more question on diluting acids
https://brainly.com/question/30438224
#SPJ11
To obtain a 0.137 HNO3 solution from a 12 M stock HNO3 solution, you will need to dilute the stock solution. The first step is to use the formula C1V1 = C2V2, where C1 is the concentration of the stock solution (12 M), V1 is the volume of the stock solution you will use, C2 is the desired concentration (0.137 M), and V2 is the final volume of the solution.
Therefore, the calculation is:
(12 M) (V1) = (0.137 M) (V2)
Solving for V2:
V2 = (12 M)(V1) / (0.137 M)
Now you need to substitute the values. You want to dilute 50 mL of the stock solution to obtain the desired concentration of 0.137 M.
So, V1 = 50 mL and C2 = 0.137 M.
V2 = (12 M)(50 mL) / (0.137 M)
V2 = 4380.29 mL or approximately 4.4 L
Therefore, you need to dilute 50 mL of the 12 M stock HNO3 solution to a final volume of approximately 4.4 L to obtain a 0.137 M HNO3 solution.
Stock solutions are commonly used in scientific research, pharmaceutical manufacturing, and various laboratory procedures. They provide a convenient way to accurately and consistently prepare solutions of desired concentrations by diluting the stock solution with a suitable solvent.
To create a stock solution, a known quantity of a solute (such as a solid or liquid) is dissolved in a solvent (usually a liquid) to achieve a high concentration. The concentration of the stock solution is often expressed in terms of molarity (moles of solute per liter of solution) or percentage (%).
When a lower concentration solution is needed, a specific volume of the stock solution is measured and diluted with additional solvent to achieve the desired concentration. This process is often performed using volumetric flasks or pipettes to ensure accurate measurements.
It is important to properly label and store stock solutions to maintain their stability and prevent contamination. The stability and shelf life of a stock solution depend on various factors, including the nature of the solute and solvent, storage conditions (temperature, light exposure, etc.), and any specific instructions provided by the manufacturer.
Overall, stock solutions play a crucial role in scientific and laboratory settings by providing a standardized and efficient way to prepare solutions of known concentrations for experimental and analytical purposes.
Learn more about stock solution click here:
https://brainly.in/question/17507550
#SPJ11
If you found two substances with the exact same properties what would that tell you?
If two substances have exactly the same properties, it indicates that they are the same substance.
This could mean that they have the same chemical composition, molecular structure, and physical characteristics. However, it is important to note that some properties may not be enough to identify a substance uniquely, and further testing may be necessary to confirm their identity.
For example, two white powders may look the same, but one could be salt (sodium chloride) and the other could be sugar (sucrose). Both are white and crystalline, but their chemical properties are different. Therefore, testing such as chemical reactions, melting points, or other analytical techniques may be needed to distinguish them. In conclusion, finding two substances with the exact same properties could indicate that they are the same substance, but further testing may be required for confirmation.
To know more about the Substances, here
https://brainly.com/question/25849631
#SPJ1
Three solids A, B, and C all have the same melting point of 170-171 C. A 50/50 mixture of A and B melts at 140 – 147 C. A 70/30 mixture of B and C melts at 170-171 C. What conclusions can one draw about the identities of A, B, and C?
It can be concluded that Solid A has a lower melting point than Solid B and Solid C. Solid B has a higher melting point than both Solid A and Solid C. Solid C has the highest melting point among the three solids.
The melting point of a substance is the temperature at which it changes from a solid to a liquid state. From the information provided, we can deduce the following:
Solid A and Solid B:
When a 50/50 mixture of Solid A and Solid B is formed, it has a lower melting point of 140-147 C. This suggests that Solid A has a lower melting point than Solid B since the mixture's melting point is below the individual melting points of both A and B.
Solid B and Solid C:
When a 70/30 mixture of Solid B and Solid C is formed, it has the same melting point as Solid C, which is 170-171 C. This indicates that Solid B has a higher melting point than Solid C since the mixture's melting point is equal to Solid C's melting point.
Combining these conclusions, we can summarize that Solid A has the lowest melting point, Solid B has a higher melting point than Solid A but lower than Solid C, and Solid C has the highest melting point among the three solids.
To learn more about lower melting point click here, brainly.com/question/30419586
#SPJ11
nai has a face-centered cubic unit cell in which the i- anions occupy corners and face centers, while the cations fit into the hole between adjacent anions. what is the radius of na if the ionic radius of i- is 216.0 pm and the density of nai is 3.667 g/cm3?
To find the radius of Na in NaI, we need to use the formula for the density of a crystal lattice:
Density = (Z × M) / (a³ × N₀)
where Z is the number of formula units in the unit cell, M is the molar mass of the compound, a is the edge length of the unit cell, and N₀ is Avogadro's number.
For NaI, Z = 4 (there are 4 I- ions per unit cell), M = 149.89 g/mol (the molar mass of NaI), and N₀ = 6.022 × 10²³. We can solve for a using the density of NaI, which is given as 3.667 g/cm³:
a = (Z × M / (Density × N₀)) ^ 1/3
Plugging in the values, we get:
a = ((4 × 149.89 g/mol) / (3.667 g/cm³ × 6.022 × 10²³)) ^ 1/3 = 5.681 Å
Now we can calculate the radius of Na using the fact that it fits into the holes between adjacent I- ions. Since the I- ion has an ionic radius of 216.0 pm, the distance between adjacent I- ions along a face diagonal of the cube is 2 × 216.0 pm = 432.0 pm = 4.320 Å. Therefore, the radius of the hole is (a / 2) - (216.0 pm / 2), or (5.681 Å / 2) - (216.0 pm / 2) = 1.962 Å.
Finally, the radius of Na is equal to the radius of the hole plus the radius of the Na+ ion. Assuming that Na+ has the same radius as K+, which is 152 pm, we get:
Radius of Na = 1.962 Å + 152 pm = 2.114 Å.
So the radius of Na in NaI is approximately 2.114 Å.
To know more about crystal lattice visit:
https://brainly.com/question/10554076
#SPJ11
Classify H2S as a strong acid or weak acid.
Hydrogen sulfide (chemical formula: H₂S) is classified as a weak acid.
What is a weak acid?A Weak Acids are the acids that do not completely dissociate into their constituent ions when dissolved in solutions. When dissolved in water, an equilibrium is established between the concentration of the weak acid and its constituent ions.
Some common examples of weak acids are listed below;
Hydrogen sulfide (chemical formula: H₂S) Formic acid (chemical formula: HCOOH)Acetic acid (chemical formula: CH₃COOH)Benzoic acid (chemical formula: C₆H₅COOH)Oxalic acid (chemical formula: C₂H₂O4)Hydrofluoric acid (chemical formula: HF)Nitrous acid (chemical formula: HNO₂)Learn more about weak acid here: https://brainly.com/question/24018697
#SPJ1
calculate the molar solubility of lead (ii) bromide (pbbr2) in pure water. ksp = 4.67×10-6.
In order to calculate the molar solubility of lead (II) bromide (PbBr2) in pure water, we need to use the solubility product constant (Ksp) which is given as 4.67x10^-6.
The equation for the dissociation of PbBr2 in water is: PbBr2(s) ↔ Pb2+(aq) + 2Br-(aq).
The Ksp expression for this reaction is: Ksp = [Pb2+][Br-]^2.
Since we are given that the water is pure, we can assume that the initial concentrations of Pb2+ and Br- are both zero.
Let x be the molar solubility of PbBr2 in water. Then at equilibrium, the concentrations of Pb2+ and Br- are both equal to x.
4.67x10^-6 = x * (2x)^2.
Simplifying the expression gives: 4.67x10^-6 = 4x^3, x = 0.00309 M.
Therefore, the molar solubility of PbBr2 in pure water is 0.00309 M.
Read more about Molar solubility.
https://brainly.com/question/28170449
#SPJ11
Lewis Structures and Formal Charge 1) Three possible Lewis structures for the thiocyanate ion, NCS, are given below: [—c=s] (n=c=s] (n=c-s)" a) Complete each structure by adding the lone pair electrons. b) Determine the formal charges of the atoms in each structure. Formal charge can be used to distinguish between competing structures. In general, the following rules apply: i) The sum of all formal charges in a neutral molecule must be zero. ii) The sum of all formal charges in an ion must equal the charge on the ion. iii) Small or zero formal charges on individual atoms are better than larger ones. iv) When formal charge cannot be avoided on an atom, negative charges are better on more electronegative atoms. c) Decide which Lewis structure is the preferred one and give an explanation below
The preferred Lewis structure for the thiocyanate ion (NCS-) is [tex][C≡N-S]⁻[/tex].
The Lewis structures and formal charges for the thiocyanate ion[tex](NCS-)[/tex]. Here are the steps:
a) Adding lone pair electrons to each structure:
1. [tex][C≡N-S]⁻: C[/tex] has 2 lone pairs, N has 1 lone pair, and S has 2 lone pairs.
2. [tex][N=C=S]⁻: N[/tex] has 2 lone pairs, C has 3 lone pairs, and S has 2 lone pairs.
3. [tex][N-C≡S]⁻: N[/tex]has 3 lone pairs, C has 2 lone pairs, and S has 1 lone pair.
b) Determining the formal charges:
1. [tex][C≡N-S]⁻: C: 0, N: 0, S: -1[/tex]
2.[tex][N=C=S]⁻: N: -1, C: 0, S: 0[/tex]
3.[tex][N-C≡S]⁻: N: -1, C: 0, S: 0[/tex]
c) Deciding the preferred Lewis structure:
Considering the rules, Structure 1 is preferred because:
i) The sum of all formal charges equals -1, which is the charge on the ion.
ii) It has smaller or zero formal charges on individual atoms.
iii) The negative charge is on the more electronegative atom (Sulfur).
So, the preferred Lewis structure for the thiocyanate ion[tex](NCS-) is [C≡N-S]⁻.[/tex]
To learn more about atom, refer below:
https://brainly.com/question/30898688
#SPJ11
A current of 0.500 A flows through a cell containing Fe2+ for 10.0 minutes. Calculate
the maximum moles of Fe that can be removed from solution? Assume constant current
over time (Faraday constant = 9.649 x 104 C/mol).
A) 1.04 mmol
B) 51.8 mol
C) 3.11 mmol
D) 1.55 mmol
E) 25.9 mol
According to the statement the maximum moles of Fe that can be removed from solution is 3.11 mmol (option C).
The solution to this question requires the use of Faraday's law of electrolysis, which states that the amount of substance produced or consumed during electrolysis is directly proportional to the quantity of electricity passed through the cell. We can use the formula:
n = (I*t)/F
where n is the number of moles of substance produced or consumed, I is the current, t is the time, and F is the Faraday constant.
In this case, we are looking for the maximum moles of Fe that can be removed from solution, so we can use the forula to calculate n:
n = (0.500 A * 600 s) / 9.649 x 104 C/mol
n = 3.10 x 10-3 mol
Therefore, the maximum moles of Fe that can be removed from solution is 3.11 mmol (option C).
To know more about solution visit :
https://brainly.com/question/32024431
#SPJ11
The normal boiling point of ethanol is 78.4 C, and the heat of vaporization is Delta H vap = 38.6 kJ / mol.
What is the boiling point of ethanol in C on top of Mt. Everest, where P = 260 mmHg.
The boiling point of ethanol on top of Mt. Everest, where the pressure is 260 mmHg, is approximately 68.5°C.
At higher altitudes, the atmospheric pressure is lower, and therefore the boiling point of liquids decreases. This is because the lower pressure reduces the vapor pressure required for boiling to occur. To calculate the boiling point of ethanol at 260 mmHg, we can use the Clausius-Clapeyron equation, which relates the vapor pressure of a substance to its temperature and heat of vaporization. By plugging in the given values for the normal boiling point, heat of vaporization, and pressure on Mt. Everest, we can solve for the new boiling point. Learn more about the Clausius-Clapeyron equation and its applications at #SPJ11.
learn more about heat of vaporization
https://brainly.com/question/13372553
#SPJ11
Of the following, which form a neutral solution? Assume all acids and bases are combined in stoichiometrically equivalent amounts. (select all that apply) Select all that apply:a) HCN(aq) + KOH(aq) ⇌ KCN(aq) + H2O(l)b) NH3(aq) + HCl(aq) ⇌ NH4Cl(aq)c) HBr(aq) + KOH(aq) ⇌ KBr(aq) + H2O(l)d) HClO4(aq) + LiOH(aq) ⇌ LiClO4(aq) + H2O(l)
The neutral solutions formed when acids and bases combined in stoichiometrically equivalent amounts are option c and option d.
The following reactions forms a neutral solution:
c) HBr(aq) + KOH(aq) ⇌ KBr(aq) + H₂O(l)
d) HClO₄(aq) + LiOH(aq) ⇌ LiClO₄(aq) + H₂O(l)
The above reactions involve the combination of an acid and a base to form a salt and water. In these reactions, the acid and base react completely to form their respective salt and water, resulting in a neutral solution. These are reaction of strong acids, HBr and HClO₄ and; strong bases, KOH and LiOH, which results in formation of neutral salts.
The NH₃(aq) + HCl(aq) ⇌ NH₄Cl(aq) reaction involve the formation of an acid salt (NH₄Cl) respectively, and therefore, do not form a neutral solution.
HCN(aq) + KOH(aq) ⇌ KCN(aq) + H₂O reaction involve weak acid plus strong base producing alkaline salts.
To learn more about neutral solutions visit:
https://brainly.com/question/31358270
#SPJ11
tow the line, inc. provides contracts with its clients that are presented on a "take-it-or-leave-it" basis. courts typically find these types of agreements to be _____.
Courts typically find "take-it-or-leave-it" agreements to be adhesion contracts.
Adhesion contracts are contracts that are drafted by one party with superior bargaining power, leaving the other party with no real opportunity to negotiate the terms. These contracts are often presented on a "take-it-or-leave-it" basis, meaning the accepting party must either agree to the terms as they are or decline the contract altogether. Courts recognize the inherent power imbalance in such agreements and generally scrutinize them more closely. The term "adhesion" refers to the idea that one party adheres to the terms set forth by the other party without having the ability to negotiate or modify them. This can occur in various contexts, including consumer contracts, employment agreements, and insurance policies. Courts tend to view adhesion contracts with caution, as they may contain terms that are unfairly one-sided and disadvantageous to the party with less bargaining power. In legal proceedings, courts may apply principles of contract law to determine the enforceability and validity of adhesion contracts. They may consider factors such as the clarity of the terms, the conspicuousness of any limitations or disclaimers, and the overall fairness of the agreement. If a court determines that the contract was unconscionable or contained unfair provisions, it may limit or invalidate certain terms to protect the rights of the accepting party.
Learn more about adhesion contract here:
https://brainly.com/question/30900071
#SPJ11
What is the main drawback to the EGBU hybrid system using both laser guidance and GPS/INS systems?
Answer:
What is the main drawback to the EGBU hybrid system using both laser guidance and GPS/INS systems? It's complexity. Both systems in one makes the weapon expensive and complicated to load l/maintain.
Explanation:
Give the major organic product of each reaction of methyl pentanoate with the given 6 reagents under the conditions shown. Do not draw any byproducts formed.
−→−−−−−Reagent→Reagent Product
a. Reaction with NaOH,H2ONaOH,H2O, heat; then H+,H2OH+,H2O.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHO
b. Reaction with (CH3)2CHCH2CH2OH(CH3)2CHCH2CH2OH (excess), H+H+.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHO
c. Reaction with (CH3CH2)2NH(CH3CH2)2NH and heat.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHNO
d. Reaction with CH3MgICH3MgI (excess), ether; then H+/H2OH+/H2O.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHO
e. Reaction with LiAlH4LiAlH4, ether; then H+/H2OH+/H2O.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHO
f. Reaction with DIBAL (diisobutylaluminum hydride), toluene, low temperature; then H+/H2OH+/H2O.
SelectDrawRingsMoreEraseSelectDrawRingsMoreEraseSelectDrawRingsMoreErase
CHO
The major organic product for this reaction sequence is pentanoic acid.
a. NaOH, H₂O, heat; then H⁺, H₂O:
The reaction with NaOH and heat will result in the saponification of methyl pentanoate to form sodium pentanoate and methanol. The sodium pentanoate will then be protonated with H+ and form the corresponding pentanoic acid.
The major organic product for this reaction sequence is pentanoic acid.
b. (CH₃)₂CHCH₂CH₂OH (excess), H+:
The reaction with (CH₃)₂CHCH₂CH₂OH and H+ is an example of an esterification reaction, which will result in the formation of an ester product.
The major organic product for this reaction is isopentyl pentanoate.
c. (CH₃CH₂)₂NH, heat:
The reaction with (CH₃CH₂)₂NH and heat is an example of an amide formation reaction, which will result in the formation of an amide product.
The major organic product for this reaction is N,N-diethylpentanamide.
d. Reaction with CH₃MgI(excess), ether; then H+/H₂O:
The reaction with CH₃MgI and excess will result in the formation of a Grignard reagent which will act as a nucleophile and attack the carbonyl group of methyl pentanoate to form a new carbon-carbon bond. The resulting product will have an alcohol functional group.
The major organic product for this reaction sequence is 3-hydroxypentanoic acid.
e. Reaction with LiAlH₄, ether; then H+/H₂O:
The reaction with LiAlH₄ is a reduction reaction, which will reduce the carbonyl group of methyl pentanoate to an alcohol group. The resulting product will have a primary alcohol functional group.
The major organic product for this reaction sequence is 3-pentanol.
f. Reaction with DIBAL (diisobutylaluminum hydride), toluene, low temperature; then H+/H₂O:
The reaction with DIBAL is a reduction reaction, which will reduce the ester group of methyl pentanoate to an aldehyde group. The aldehyde group can then be further reduced to an alcohol group with H+/H₂O.
The major organic product for this reaction sequence is 3-pentanol.
The Correct Question is:
Give the major organic product of each reaction of methyl pentanoate with the following reagents under the conditions shown. Do not draw any byproducts formed.
a. NaOH, H₂O, heat; then H+, H₂O
b. (CH₃)₂CHCH₂CH₂OH (excess), H+
c. (CH₃CH₂)₂NH, heat
d. Reaction with CH₃MgI(excess), ether; then H+/H₂O
e. Reaction with LiAlH₄, ether; then H+/H₂O
f. Reaction with DIBAL (diisobutylaluminum hydride), toluene, low temperature; then H+/H₂O
To know more about pentanoic acid follow the link:
https://brainly.com/question/16945257
#SPJ4
the reaction of 4-pentanoylbiphenyl and hydrazine without potassium hydroxide is a net? a. substitution b. addition c. rearrangement d. elimination
The reaction of 4-pentanoylbiphenyl and hydrazine without potassium hydroxide is a net addition reaction. The correct option is b.
When 4-pentanoylbiphenyl reacts with hydrazine in the absence of potassium hydroxide, the carbonyl group of the 4-pentanoylbiphenyl undergoes addition reaction with hydrazine to form a hydrazone product. This is an example of a net addition reaction, where two molecules combine to form a single product.
The reaction does not involve the substitution of any functional groups, rearrangement of atoms or elimination of any functional group. The absence of potassium hydroxide in the reaction mixture does not influence the mechanism of the reaction but rather affects the rate of reaction. Potassium hydroxide is often used as a catalyst in the reaction to increase the rate of the reaction. Therefore, the correct option is b.
To know more about catalyst refer here:
https://brainly.com/question/31630881#
#SPJ11
through a balanced equation of combustion, calculate the oxygen balance of ammonium nitrate
To determine the oxygen balance of ammonium nitrate through a balanced equation of combustion is 33.33%
Ammonium nitrate (NH4NO3) is an oxidizer commonly used in fertilizers and explosives. Its combustion reaction can be represented by a balanced chemical equation. To determine the oxygen balance, we first need to write the balanced equation for the combustion of ammonium nitrate.
The balanced equation for the decomposition of ammonium nitrate is:
NH4NO3 (s) → N2O (g) + 2H2O (g)
Now, we can calculate the oxygen balance. Oxygen balance is the difference between the oxygen content in the reactants and products, expressed as a percentage of the total oxygen content in the reactants. The formula for oxygen balance is:
Oxygen Balance = [(Oxygen in Products - Oxygen in Reactants) / Oxygen in Reactants] × 100%
In our equation, the oxygen content in the reactants (ammonium nitrate) is 3 moles, while in the products (N2O and 2H2O), the total oxygen content is 2 + (2 × 1) = 4 moles.
Now we can apply the formula:
Oxygen Balance = [(4 - 3) / 3] × 100% = (1 / 3) × 100% ≈ 33.33%
So, the oxygen balance of ammonium nitrate in its combustion reaction is approximately 33.33%. This means that during the decomposition, there is a surplus of oxygen available in the products, which is a characteristic of an effective oxidizer.
Know more about Ammonium Nitrate here:
https://brainly.com/question/29341539
#SPJ11
calculate the ph of solutions containing 200 mg/l of each of the following weak acids or salts of weak acids: a. acetic acid b. hypochlorous acid c. ammonia d. hydrocyanic acid
The dissociation constant (Ka) or equilibrium constant (Kb) for the acid or base, as well as the concentration of the acid or base in solution, must be known in order to compute the pH of solutions containing weak acids or salts of weak acids.
a. Acetic acid (CH3COOH) has a Ka of 1.8 x 10-5, making it a weak acid. We must translate the concentration to moles per litre (mol/L) in order to calculate the pH of a solution containing 200 mg/L of acetic acid.
200 mg/L is equivalent to 0.2 g/L, 0.2/60 g/mol, or 0.00333 mol/L.
The concentration of H+ ions in solution may now be determined using the equation for the dissociation of acetic acid:
H2O + CH3COOH H3O+ + CH3COO-
Ka is equal to [CH3COO-][H3O+]/[CH3COOH].
Given that the acid is weak, [CH3COO-] = [H3O+] and [CH3COOH] - [CH3COO-], we can write:
Ka is equal to [H3O+]2 / [CH3COOH - [H3O+]].
If you rewrite this equation, you get:
(Ka*[CH3COOH - [H3O+]]) = [H3O+]
Inputting the values, we obtain:
[H3O+] = 0.00135 mol/L (1.8 x 10-5 * 0.00333 mol/L)
pH = -log(0.00135)/-log(-log[H3O+] = 2.87
As a result, a solution with 200 mg/L of acetic acid has a pH of roughly 2.87.
b. Hypochlorous acid (HOCl), which has a Ka of 3.5 x 10-8, is a weak acid. We must convert the concentration to moles per litre (mol/L) in order to determine the pH of a solution containing 200 mg/L of HOCl.
200 mg/L is equal to 0.2 g/L, or 0.2/52.46 g/mol, or 0.00381 mol/L.
The concentration of H+ ions in solution can now be determined using the equation for the dissociation of hypochlorous acid:
OCl- + H3O+ = HOCl + H2O
Ka is equal to [OCl-][H3O+]/[HOCl].
Given that the acid is weak, [OCl-] = [H3O+] and [HOCl] - [OCl-], we can write:
Ka = [HOCl - [H3O+]] / [H3O+]2.
If you rewrite this equation, you get:
(Ka*[HOCl - [H3O+]]) = [H3O+]
Inputting the values, we obtain:
[H3O+] is equal to (3.5 x 10-8 * 0.00381 mol/L) = 6.12 x 10-5 mol/L.
pH = -log[H3O+] = -log(6.12 x 10-5), which equals 4.21.
As a result, a solution with 200 mg/L of hypochlorous acid has a pH of roughly 4.21.
c. Ammonia (NH3) has a Kb of 1.8 x 10-5 and is a weak base. In order to get the pH of a solution with 200 mg/L of ammonia, we must convert
For more such question on pH
https://brainly.com/question/31380289
#SPJ11
A solution with 200 mg/L of hypochlorous acid has a pH of roughly 4.21. c. Ammonia (NH3) has a Kb of 1.8 x 10-5 and is a weak base. In order to get the pH of a solution with 200 mg/L of ammonia, we must convert
The dissociation constant (Ka) or equilibrium constant (Kb) for the acid or base, as well as the concentration of the acid or base in solution, must be known in order to compute the pH of solutions containing weak acids or salts of weak acids. a. Acetic acid (CH3COOH) has a Ka of 1.8 x 10-5, making it a weak acid. We must translate the concentration to moles per litre (mol/L) in order to calculate the pH of a solution containing 200 mg/L of acetic acid.
200 mg/L is equivalent to 0.2 g/L, 0.2/60 g/mol, or 0.00333 mol/L.
The concentration of H+ ions in solution may now be determined using the equation for the dissociation of acetic acid:
H2O + CH3COOH H3O+ + CH3COO-
Ka is equal to [CH3COO-][H3O+]/[CH3COOH].
Given that the acid is weak, [CH3COO-] = [H3O+] and [CH3COOH] - [CH3COO-], we can write:
Ka is equal to [H3O+]2 / [CH3COOH - [H3O+]].
If you rewrite this equation, you get:
(Ka*[CH3COOH - [H3O+]]) = [H3O+]
Inputting the values, we obtain:
[H3O+] = 0.00135 mol/L (1.8 x 10-5 * 0.00333 mol/L)
pH = -log(0.00135)/-log(-log[H3O+] = 2.87
As a result, a solution with 200 mg/L of acetic acid has a pH of roughly 2.87.
b. Hypochlorous acid (HOCl), which has a Ka of 3.5 x 10-8, is a weak acid. We must convert the concentration to moles per litre (mol/L) in order to determine the pH of a solution containing 200 mg/L of HOCl.
200 mg/L is equal to 0.2 g/L, or 0.2/52.46 g/mol, or 0.00381 mol/L.
The concentration of H+ ions in solution can now be determined using the equation for the dissociation of hypochlorous acid:
OCl- + H3O+ = HOCl + H2O
Ka is equal to [OCl-][H3O+]/[HOCl].
Given that the acid is weak, [OCl-] = [H3O+] and [HOCl] - [OCl-], we can write: Ka = [HOCl - [H3O+]] / [H3O+]2.
If you rewrite this equation, you get:
(Ka*[HOCl - [H3O+]]) = [H3O+]
Inputting the values, we obtain:
[H3O+] is equal to (3.5 x 10-8 * 0.00381 mol/L) = 6.12 x 10-5 mol/L.
pH = -log[H3O+] = -log(6.12 x 10-5), which equals 4.21.
Learn more about pH here:
brainly.com/question/31380289
#SPJ11
Use crystal field theory to predict the unpaired elections for the following and determine the magnetic moments (spin-only): (a) [Co(H₂O)6]²+ (b) [Cr(H₂O)6]³+ (c) [Fe(CN)6]³- (d) [Fe(CO);]
The predicted number of unpaired electrons and magnetic moments (spin-only) are as follows:
(a) [Co(H₂O)₆]²+: 3 unpaired electrons, magnetic moment of 3.87 BM
(b) [Cr(H₂O)₆]³+: 3 unpaired electrons, magnetic moment of 3.87 BM
(c) [Fe(CN)₆]³-: 0 unpaired electrons, magnetic moment of 0 BM
(d) [Fe(CO)]: 4 unpaired electrons, magnetic moment of 4.92 BM
How does crystal field theory predict electronic configurations and magnetic moments?According to crystal field theory, transition metal ions in coordination complexes experience an interaction between their d-orbitals and the ligand field created by surrounding ligands.
This interaction leads to the splitting of the d-orbitals into higher energy and lower energy sets.
The energy difference between these sets determines the electronic configuration and magnetic properties of the complex.
How does weak field ligand affect unpaired electrons in [Co(H₂O)₆]²+?In the case of [Co(H₂O)₆]²+, the cobalt ion (Co²+) has a d⁶ electronic configuration. The six water ligands (H₂O) act as weak field ligands, causing a small energy difference between the d-orbitals.
As a result, three of the six d-electrons occupy the higher energy orbitals, leaving three unpaired electrons.
The presence of unpaired electrons gives rise to a magnetic moment of 3.87 Bohr magnetons (BM).
How do weak field ligands result in three unpaired electrons in [Cr(H₂O)₆]³+?Similarly, for [Cr(H₂O)₆]³+, the chromium ion (Cr³+) also has a d³ electronic configuration. The six water ligands are again weak field ligands, leading to a small energy difference between the d-orbitals.
Three of the three d-electrons occupy the higher energy orbitals, resulting in three unpaired electrons and a magnetic moment of 3.87 BM.
How do strong field ligands result in the absence of unpaired electrons in [Fe(CN)₆]³-?In the case of [Fe(CN)₆]³-, the iron ion (Fe³+) has a d⁶ electronic configuration. The cyanide ligands (CN⁻) are strong field ligands, causing a large energy difference between the d-orbitals.
This large energy difference leads to the pairing of all six d-electrons, resulting in the absence of unpaired electrons and a magnetic moment of 0 BM.
How do strong field ligands result in the presence of four unpaired electrons in [Fe(CO)]?[Fe(CO)] features an iron ion (Fe) with a d⁸ electronic configuration. Carbon monoxide ligands (CO) are also strong field ligands, causing a large energy difference between the d-orbitals.
This energy difference leads to the pairing of four of the eight d-electrons, leaving four unpaired electrons.
The presence of four unpaired electrons gives rise to a magnetic moment of 4.92 BM.
Learn more about crystal field theory
brainly.com/question/29389010
#SPJ11
Calculate the normal boiling point of liquid Q if the vapor pressure is .500 atm at 20 degrees C. The change/ delta of H of vaporization for liquid Q is 26 kJ/ mole. Do you except liquid Q to have H bonds?
The normal boiling point of liquid Q is 136.3 degrees C.
Liquid Q is expected to have H bonds because of the high boiling point
What is the normal boiling point of Liquid Q?The normal boiling point of liquid Q can be calculated using the Clausius-Clapeyron equation given below:
[tex]ln(P_2/P_1) = -\Delta H_{vap}/R * (1/T_2 - 1/T_1)[/tex]
where
P1 and T1 are the initial vapor pressure and temperature, P2 is the vapor pressure at the boiling point (1 atm),T2 is the boiling point (in Kelvin), ΔHvap is the enthalpy of vaporization,R is the gas constant (8.314 J/(mol*K)).T1 = 20 °C in Kelvin will be:
T1 = 20 + 273.15
T1 = 293.15 K
Substituting the given values and solving for T2:
ln(1/.500) = -2610³ J/mol / (8.314 J/(molK)) * (1/T2 - 1/293.15 K)
ln(2) = -3132.6 * (1/T2 - 1/293.15)
1/T2 - 1/293.15 = -ln(2) / 3132.6
1/T2 = 1/293.15 - ln(2) / 3132.6
T2 = 409.4 K
Normal boiling point = (409.4 - 273.15)
Normal boiling point = 136.3 °C.
Learn more about the normal boiling point at: https://brainly.com/question/13130654
#SPJ1
draw a diastereomer for each of the following molecules (2 pts)
The diastereomer are the pairs of the compounds which are the neither superimposable nor the mirror images of the each other.
The Diastereomers are the compounds in which the compound have the same molecular formula and the sequence of the bonded elements and that are non superimposable, the non-mirror images.
The Diastereomers are such the stereoisomers which are the non identical, and they do not have the mirror images, and therefore they are the non-superimposable on the each other. Enantiomers are the such pair of the molecules which will not exist in the two forms which is the mirror images of the one another and it cannot be the superimposed one on the other.
To learn more about diastereomer here :
https://brainly.com/question/21506956
#SPJ4
This question is incomplete, the complete question is :
draw a diastereomer for each of the following molecules.
OH CH₃
| |
OH- CH - CH - OH
The Henderson-Hasselbach equation, used to calculate the pH of simple conjugate- pair buffer systems, would be expressed for an ammonia/ammonium chloride buffer as Kb(NH3) is 1.8 x 10-5 OpH = 14.0 - log(1.8 x 10-5) O pH = 4.74 + log((NH4+]/[NH31) O pH = 9.25 + log(NH4+]/[NH3) OpH = 9.25 + log(NH3][NH4+1) OpH = 4.74 + log(NH3]/[NH4+])
The Henderson-Hasselbach equation is used to calculate the pH of a simple conjugate-pair buffer system. For an ammonia/ammonium chloride buffer, the equation would be expressed as pH = 9.25 + log([NH4+]/[NH3]).
This equation takes into account the equilibrium between the weak acid (NH4+) and its conjugate base (NH3) and the dissociation constant (Kb) of the weak base (NH3), which is given as 1.8 x 10-5. By knowing the concentration of the weak acid and its conjugate base, the pH of the buffer solution can be calculated.
The correct expression of the Henderson-Hasselbalch equation for an ammonia/ammonium chloride buffer system would be:
pH = 9.25 + log([NH4+]/[NH3])
This equation takes into account the pKa value (9.25) of the conjugate acid (NH4+) and the ratio of the concentrations of the conjugate acid ([NH4+]) and base ([NH3]) in the buffer solution.
To know more about ammonium chloride buffer visit:-
https://brainly.com/question/31278059
#SPJ11
An alternating current complete 100 cycles in 0. 1s. It's frequency is
The frequency of an alternating current that completes 100 cycles in 0.1s can be calculated by dividing the number of cycles by the time taken. The frequency of the alternating current is 1000 Hz.
Frequency is a measure of how many cycles of a periodic waveform occur per unit of time. In this case, we are given that the alternating current completes 100 cycles in 0.1s. To calculate the frequency, we divide the number of cycles by the time taken.
Frequency (f) = Number of cycles / Time
Given:
Number of cycles = 100
Time = 0.1s
Substituting the values into the formula, we have:
Frequency = 100 cycles / 0.1s
Simplifying the calculation, we find:
Frequency = 1000 Hz
Therefore, the frequency of the alternating current that completes 100 cycles in 0.1s is 1000 Hz. This means that the alternating current oscillates back and forth 1000 times per second.
Learn more about alternating current here:
https://brainly.com/question/31609186
#SPJ11
Determine the number of moles of carbon dioxide that will remain when 1.720 g of sodium hydroxide is reacted completely with 1.016 g of carbon dioxide?
2NaOH + CO2 ⟶⟶ Na2CO3 + H2O
Group of answer choices
1) 1.585×10^−3mol
2) 1.585×10^3mol
3) 1.585×10^-2mol
4) 2.309×10^-2mol
To determine the number of moles of carbon dioxide that will remain when 1.720 g of sodium hydroxide reacts completely with 1.016 g of carbon dioxide, we need to use stoichiometry and the balanced chemical equation given.
First, we need to convert the given masses into moles.
Moles of NaOH = 1.720 g / 40.00 g/mol = 0.0430 mol
Moles of CO2 = 1.016 g / 44.01 g/mol = 0.0231 mol
Next, we need to determine which reactant is limiting. The balanced chemical equation shows that 2 moles of NaOH react with 1 mole of CO2. Therefore, the number of moles of CO2 needed to react completely with 0.0430 mol of NaOH is:
0.0430 mol NaOH x (1 mol CO2 / 2 mol NaOH) = 0.0215 mol CO2
Since we have 0.0231 mol of CO2, we can see that CO2 is in excess and NaOH is limiting.
Using the stoichiometry of the balanced equation, we can calculate the number of moles of Na2CO3 formed:
0.0430 mol NaOH x (1 mol Na2CO3 / 2 mol NaOH) = 0.0215 mol Na2CO3
Therefore, the number of moles of CO2 that remain is:
0.0231 mol CO2 - 0 mol CO2 (since it reacts completely) = 0.0231 mol CO2
The answer is not one of the given choices, but it is important to note that the remaining amount of CO2 is in excess and not involved in the reaction.
In conclusion, the number of moles of carbon dioxide that will remain when 1.720 g of sodium hydroxide is reacted completely with 1.016 g of carbon dioxide is 0.0231 mol.
To know more about NaOH visit:
https://brainly.com/question/29854404
#SPJ11